C20H17ClN2O — CID 134022555
1-(3-chlorophenyl)-N-quinolin-8-ylcyclobutane-1-carboxamide (PubChem CID 134022555) has the molecular formula C20H17ClN2O and a molecular weight of 336.82 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-quinolin-8-ylcyclobutane-1-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-N-quinolin-8-ylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 134022555 |
| Molecular Formula | C20H17ClN2O |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 1-(3-chlorophenyl)-N-quinolin-8-ylcyclobutane-1-carboxamide |
| SMILES | O=C(Nc1cccc2cccnc12)C1(c2cccc(Cl)c2)CCC1 |
| InChI | InChI=1S/C20H17ClN2O/c21-16-8-2-7-15(13-16)20(10-4-11-20)19(24)23-17-9-1-5-14-6-3-12-22-18(14)17/h1-3,5-9,12-13H,4,10-11H2,(H,23,24) |
| InChIKey | ZOGJIZVRLQKKQQ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |