C19H31BN2O5S — CID 66701783
2-[2-(hydroxymethyl)pyrrolidin-1-yl]-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanesulfonamide (PubChem CID 66701783) has the molecular formula C19H31BN2O5S and a molecular weight of 410.35 g/mol. Its IUPAC name is 2-[2-(hydroxymethyl)pyrrolidin-1-yl]-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanesulfonamide.
| Compound Name | 2-[2-(hydroxymethyl)pyrrolidin-1-yl]-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 66701783 |
| Molecular Formula | C19H31BN2O5S |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 2-[2-(hydroxymethyl)pyrrolidin-1-yl]-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanesulfonamide |
| SMILES | CC1(C)OB(c2cccc(NS(=O)(=O)CCN3CCCC3CO)c2)OC1(C)C |
| InChI | InChI=1S/C19H31BN2O5S/c1-18(2)19(3,4)27-20(26-18)15-7-5-8-16(13-15)21-28(24,25)12-11-22-10-6-9-17(22)14-23/h5,7-8,13,17,21,23H,6,9-12,14H2,1-4H3 |
| InChIKey | CHJQFLIVRXMGFD-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|