C14H20BClO5S — CID 90446935
[2-chloro-6-methylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol (PubChem CID 90446935) has the molecular formula C14H20BClO5S and a molecular weight of 346.64 g/mol. Its IUPAC name is [2-chloro-6-methylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol.
| Compound Name | [2-chloro-6-methylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol |
|---|---|
| PubChem CID | 90446935 |
| Molecular Formula | C14H20BClO5S |
| Molecular Weight | 346.64 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | [2-chloro-6-methylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol |
| SMILES | CC1(C)OB(c2cc(Cl)c(CO)c(S(C)(=O)=O)c2)OC1(C)C |
| InChI | InChI=1S/C14H20BClO5S/c1-13(2)14(3,4)21-15(20-13)9-6-11(16)10(8-17)12(7-9)22(5,18)19/h6-7,17H,8H2,1-5H3 |
| InChIKey | LZQKHLHPUDLORT-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.64 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|