C15H23BO4S — CID 123564274
[2-methylsulfonyl-4-(4,4,5,5-tetramethyloxaborolan-2-yl)phenyl]methanol (PubChem CID 123564274) has the molecular formula C15H23BO4S and a molecular weight of 310.22 g/mol. Its IUPAC name is [2-methylsulfonyl-4-(4,4,5,5-tetramethyloxaborolan-2-yl)phenyl]methanol.
| Compound Name | [2-methylsulfonyl-4-(4,4,5,5-tetramethyloxaborolan-2-yl)phenyl]methanol |
|---|---|
| PubChem CID | 123564274 |
| Molecular Formula | C15H23BO4S |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | [2-methylsulfonyl-4-(4,4,5,5-tetramethyloxaborolan-2-yl)phenyl]methanol |
| SMILES | CC1(C)CB(c2ccc(CO)c(S(C)(=O)=O)c2)OC1(C)C |
| InChI | InChI=1S/C15H23BO4S/c1-14(2)10-16(20-15(14,3)4)12-7-6-11(9-17)13(8-12)21(5,18)19/h6-8,17H,9-10H2,1-5H3 |
| InChIKey | CTXNLVALKGDHJX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|