C13H19BO — CID 91532624
4,4,5,5-tetramethyl-2-phenyloxaborolane (PubChem CID 91532624) has the molecular formula C13H19BO and a molecular weight of 202.11 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-phenyloxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-phenyloxaborolane |
|---|---|
| PubChem CID | 91532624 |
| Molecular Formula | C13H19BO |
| Molecular Weight | 202.11 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-phenyloxaborolane |
| SMILES | CC1(C)CB(c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C13H19BO/c1-12(2)10-14(15-13(12,3)4)11-8-6-5-7-9-11/h5-9H,10H2,1-4H3 |
| InChIKey | WFKZDXOBYULPHR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.11 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|