C33H35BO — CID 145170093
4,4,5,5-tetramethyl-2-[4-[4-methyl-3-(2-methylphenyl)-5-phenylphenyl]phenyl]oxaborolane (PubChem CID 145170093) has the molecular formula C33H35BO and a molecular weight of 458.45 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[4-[4-methyl-3-(2-methylphenyl)-5-phenylphenyl]phenyl]oxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[4-[4-methyl-3-(2-methylphenyl)-5-phenylphenyl]phenyl]oxaborolane |
|---|---|
| PubChem CID | 145170093 |
| Molecular Formula | C33H35BO |
| Molecular Weight | 458.45 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[4-[4-methyl-3-(2-methylphenyl)-5-phenylphenyl]phenyl]oxaborolane |
| SMILES | Cc1ccccc1-c1cc(-c2ccc(B3CC(C)(C)C(C)(C)O3)cc2)cc(-c2ccccc2)c1C |
| InChI | InChI=1S/C33H35BO/c1-23-12-10-11-15-29(23)31-21-27(20-30(24(31)2)26-13-8-7-9-14-26)25-16-18-28(19-17-25)34-22-32(3,4)33(5,6)35-34/h7-21H,22H2,1-6H3 |
| InChIKey | WSVWYBUQCHITAC-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.45 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|