C44H42BNO2 — CID 144831057
4-[4-[[2-(2-methylphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]phenyl]-N,N-diphenylaniline (PubChem CID 144831057) has the molecular formula C44H42BNO2 and a molecular weight of 627.64 g/mol. Its IUPAC name is 4-[4-[[2-(2-methylphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]phenyl]-N,N-diphenylaniline.
| Compound Name | 4-[4-[[2-(2-methylphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]phenyl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 144831057 |
| Molecular Formula | C44H42BNO2 |
| Molecular Weight | 627.64 g/mol |
| Exact Mass | 627.33 |
| IUPAC Name | 4-[4-[[2-(2-methylphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]phenyl]-N,N-diphenylaniline |
| SMILES | Cc1ccccc1-c1ccc(B2OC(C)(C)C(C)(C)O2)cc1Cc1ccc(-c2ccc(N(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C44H42BNO2/c1-32-14-12-13-19-41(32)42-29-26-37(45-47-43(2,3)44(4,5)48-45)31-36(42)30-33-20-22-34(23-21-33)35-24-27-40(28-25-35)46(38-15-8-6-9-16-38)39-17-10-7-11-18-39/h6-29,31H,30H2,1-5H3 |
| InChIKey | UWUYUVPTXGQHTD-UHFFFAOYSA-N |
| XLogP | 10.69 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.64 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|