C61H56B2F2N2O4 — CID 164737678
9,9-difluoro-3-N,6-N-bis(4-phenylphenyl)-3-N,6-N-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]fluorene-3,6-diamine (PubChem CID 164737678) has the molecular formula C61H56B2F2N2O4 and a molecular weight of 940.75 g/mol. Its IUPAC name is 9,9-difluoro-3-N,6-N-bis(4-phenylphenyl)-3-N,6-N-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]fluorene-3,6-diamine.
| Compound Name | 9,9-difluoro-3-N,6-N-bis(4-phenylphenyl)-3-N,6-N-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]fluorene-3,6-diamine |
|---|---|
| PubChem CID | 164737678 |
| Molecular Formula | C61H56B2F2N2O4 |
| Molecular Weight | 940.75 g/mol |
| Exact Mass | 940.44 |
| IUPAC Name | 9,9-difluoro-3-N,6-N-bis(4-phenylphenyl)-3-N,6-N-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]fluorene-3,6-diamine |
| SMILES | CC1(C)OB(c2ccc(N(c3ccc(-c4ccccc4)cc3)c3ccc4c(c3)-c3cc(N(c5ccc(B6OC(C)(C)C(C)(C)O6)cc5)c5ccc(-c6ccccc6)cc5)ccc3C4(F)F)cc2)OC1(C)C |
| InChI | InChI=1S/C61H56B2F2N2O4/c1-57(2)58(3,4)69-62(68-57)45-23-31-49(32-24-45)66(47-27-19-43(20-28-47)41-15-11-9-12-16-41)51-35-37-55-53(39-51)54-40-52(36-38-56(54)61(55,64)65)67(48-29-21-44(22-30-48)42-17-13-10-14-18-42)50-33-25-46(26-34-50)63-70-59(5,6)60(7,8)71-63/h9-40H,1-8H3 |
| InChIKey | GYLMIJZYIORZHE-UHFFFAOYSA-N |
| XLogP | 14.68 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 940.75 |
| LogP ≤ 5 | 14.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|