C15H23BN2O — CID 176574372
ethane;5-(4,4,5,5-tetramethyloxaborolan-2-yl)pyridine-3-carbonitrile (PubChem CID 176574372) has the molecular formula C15H23BN2O and a molecular weight of 258.17 g/mol. Its IUPAC name is ethane;5-(4,4,5,5-tetramethyloxaborolan-2-yl)pyridine-3-carbonitrile.
| Compound Name | ethane;5-(4,4,5,5-tetramethyloxaborolan-2-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 176574372 |
| Molecular Formula | C15H23BN2O |
| Molecular Weight | 258.17 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | ethane;5-(4,4,5,5-tetramethyloxaborolan-2-yl)pyridine-3-carbonitrile |
| SMILES | CC.CC1(C)CB(c2cncc(C#N)c2)OC1(C)C |
| InChI | InChI=1S/C13H17BN2O.C2H6/c1-12(2)9-14(17-13(12,3)4)11-5-10(6-15)7-16-8-11;1-2/h5,7-8H,9H2,1-4H3;1-2H3 |
| InChIKey | MWYGVENLKUVCFU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.17 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|