C18H28BN3O — CID 147178193
3-cyclopentyl-3-[4-(4,4,5,5-tetramethyloxaborolan-2-yl)pyrazol-1-yl]propanenitrile (PubChem CID 147178193) has the molecular formula C18H28BN3O and a molecular weight of 313.25 g/mol. Its IUPAC name is 3-cyclopentyl-3-[4-(4,4,5,5-tetramethyloxaborolan-2-yl)pyrazol-1-yl]propanenitrile.
| Compound Name | 3-cyclopentyl-3-[4-(4,4,5,5-tetramethyloxaborolan-2-yl)pyrazol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 147178193 |
| Molecular Formula | C18H28BN3O |
| Molecular Weight | 313.25 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | 3-cyclopentyl-3-[4-(4,4,5,5-tetramethyloxaborolan-2-yl)pyrazol-1-yl]propanenitrile |
| SMILES | CC1(C)CB(c2cnn(C(CC#N)C3CCCC3)c2)OC1(C)C |
| InChI | InChI=1S/C18H28BN3O/c1-17(2)13-19(23-18(17,3)4)15-11-21-22(12-15)16(9-10-20)14-7-5-6-8-14/h11-12,14,16H,5-9,13H2,1-4H3 |
| InChIKey | BZBBCQKHJKMKMC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.25 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|