C23H27N7S — CID 143806580
3-cyclopentyl-3-[4-[5-methyl-2-[4-(methylsulfanylamino)anilino]pyrimidin-4-yl]pyrazol-1-yl]propanenitrile (PubChem CID 143806580) has the molecular formula C23H27N7S and a molecular weight of 433.59 g/mol. Its IUPAC name is 3-cyclopentyl-3-[4-[5-methyl-2-[4-(methylsulfanylamino)anilino]pyrimidin-4-yl]pyrazol-1-yl]propanenitrile.
| Compound Name | 3-cyclopentyl-3-[4-[5-methyl-2-[4-(methylsulfanylamino)anilino]pyrimidin-4-yl]pyrazol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 143806580 |
| Molecular Formula | C23H27N7S |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 3-cyclopentyl-3-[4-[5-methyl-2-[4-(methylsulfanylamino)anilino]pyrimidin-4-yl]pyrazol-1-yl]propanenitrile |
| SMILES | CSNc1ccc(Nc2ncc(C)c(-c3cnn(C(CC#N)C4CCCC4)c3)n2)cc1 |
| InChI | InChI=1S/C23H27N7S/c1-16-13-25-23(27-19-7-9-20(10-8-19)29-31-2)28-22(16)18-14-26-30(15-18)21(11-12-24)17-5-3-4-6-17/h7-10,13-15,17,21,29H,3-6,11H2,1-2H3,(H,25,27,28) |
| InChIKey | XJYJTZWGBWYEEG-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 91.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|