C19H23N6+ — CID 163767028
(3R)-3-cyclopentyl-3-[4-(7,7-dimethylpyrrolo[2,3-d]pyrimidin-7-ium-4-yl)pyrazol-1-yl]propanenitrile (PubChem CID 163767028) has the molecular formula C19H23N6+ and a molecular weight of 335.44 g/mol. Its IUPAC name is (3R)-3-cyclopentyl-3-[4-(7,7-dimethylpyrrolo[2,3-d]pyrimidin-7-ium-4-yl)pyrazol-1-yl]propanenitrile.
| Compound Name | (3R)-3-cyclopentyl-3-[4-(7,7-dimethylpyrrolo[2,3-d]pyrimidin-7-ium-4-yl)pyrazol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 163767028 |
| Molecular Formula | C19H23N6+ |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | (3R)-3-cyclopentyl-3-[4-(7,7-dimethylpyrrolo[2,3-d]pyrimidin-7-ium-4-yl)pyrazol-1-yl]propanenitrile |
| SMILES | C[N+]1(C)C=Cc2c(-c3cnn([C@H](CC#N)C4CCCC4)c3)ncnc21 |
| InChI | InChI=1S/C19H23N6/c1-25(2)10-8-16-18(21-13-22-19(16)25)15-11-23-24(12-15)17(7-9-20)14-5-3-4-6-14/h8,10-14,17H,3-7H2,1-2H3/q+1/t17-/m1/s1 |
| InChIKey | IUQKZHJTLMMZAJ-QGZVFWFLSA-N |
| XLogP | 3.54 |
| TPSA | 67.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|