C16H19N6O4P — CID 53372673
(3S)-3-cyclobutyl-3-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]propanenitrile;phosphoric acid (PubChem CID 53372673) has the molecular formula C16H19N6O4P and a molecular weight of 390.34 g/mol. Its IUPAC name is (3S)-3-cyclobutyl-3-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]propanenitrile;phosphoric acid.
| Compound Name | (3S)-3-cyclobutyl-3-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]propanenitrile;phosphoric acid |
|---|---|
| PubChem CID | 53372673 |
| Molecular Formula | C16H19N6O4P |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | (3S)-3-cyclobutyl-3-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]propanenitrile;phosphoric acid |
| SMILES | N#CC[C@@H](C1CCC1)n1cc(-c2ncnc3[nH]ccc23)cn1.O=P(O)(O)O |
| InChI | InChI=1S/C16H16N6.H3O4P/c17-6-4-14(11-2-1-3-11)22-9-12(8-21-22)15-13-5-7-18-16(13)20-10-19-15;1-5(2,3)4/h5,7-11,14H,1-4H2,(H,18,19,20);(H3,1,2,3,4)/t14-;/m0./s1 |
| InChIKey | JHTUVISJBVJNTB-UQKRIMTDSA-N |
| XLogP | 2.15 |
| TPSA | 160.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|