C17H20N8O2 — CID 123489134
3-(2,2-diamino-5,5-dihydroxycyclopentyl)-3-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]propanenitrile (PubChem CID 123489134) has the molecular formula C17H20N8O2 and a molecular weight of 368.40 g/mol. Its IUPAC name is 3-(2,2-diamino-5,5-dihydroxycyclopentyl)-3-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]propanenitrile.
| Compound Name | 3-(2,2-diamino-5,5-dihydroxycyclopentyl)-3-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 123489134 |
| Molecular Formula | C17H20N8O2 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 3-(2,2-diamino-5,5-dihydroxycyclopentyl)-3-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]propanenitrile |
| SMILES | N#CCC(C1C(N)(N)CCC1(O)O)n1cc(-c2ncnc3[nH]ccc23)cn1 |
| InChI | InChI=1S/C17H20N8O2/c18-5-1-12(14-16(19,20)3-4-17(14,26)27)25-8-10(7-24-25)13-11-2-6-21-15(11)23-9-22-13/h2,6-9,12,14,26-27H,1,3-4,19-20H2,(H,21,22,23) |
| InChIKey | OHDVCARJFBGONM-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 175.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|