C20H20F3N5O2 — CID 86613013
4-[1-(1-cyclopentylbut-3-ynyl)pyrazol-4-yl]-7H-pyrrolo[2,3-d]pyrimidine;2,2,2-trifluoroacetic acid (PubChem CID 86613013) has the molecular formula C20H20F3N5O2 and a molecular weight of 419.41 g/mol. Its IUPAC name is 4-[1-(1-cyclopentylbut-3-ynyl)pyrazol-4-yl]-7H-pyrrolo[2,3-d]pyrimidine;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[1-(1-cyclopentylbut-3-ynyl)pyrazol-4-yl]-7H-pyrrolo[2,3-d]pyrimidine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 86613013 |
| Molecular Formula | C20H20F3N5O2 |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 4-[1-(1-cyclopentylbut-3-ynyl)pyrazol-4-yl]-7H-pyrrolo[2,3-d]pyrimidine;2,2,2-trifluoroacetic acid |
| SMILES | C#CCC(C1CCCC1)n1cc(-c2ncnc3[nH]ccc23)cn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H19N5.C2HF3O2/c1-2-5-16(13-6-3-4-7-13)23-11-14(10-22-23)17-15-8-9-19-18(15)21-12-20-17;3-2(4,5)1(6)7/h1,8-13,16H,3-7H2,(H,19,20,21);(H,6,7) |
| InChIKey | ZWIKNDYCWZCMJQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|