C20H18F3N5O2 — CID 87388207
[4-[1-(1-cyclopentylbut-3-ynyl)pyrazol-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-2-yl] 2,2,2-trifluoroacetate (PubChem CID 87388207) has the molecular formula C20H18F3N5O2 and a molecular weight of 417.39 g/mol. Its IUPAC name is [4-[1-(1-cyclopentylbut-3-ynyl)pyrazol-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [4-[1-(1-cyclopentylbut-3-ynyl)pyrazol-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87388207 |
| Molecular Formula | C20H18F3N5O2 |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | [4-[1-(1-cyclopentylbut-3-ynyl)pyrazol-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-2-yl] 2,2,2-trifluoroacetate |
| SMILES | C#CCC(C1CCCC1)n1cc(-c2nc(OC(=O)C(F)(F)F)nc3[nH]ccc23)cn1 |
| InChI | InChI=1S/C20H18F3N5O2/c1-2-5-15(12-6-3-4-7-12)28-11-13(10-25-28)16-14-8-9-24-17(14)27-19(26-16)30-18(29)20(21,22)23/h1,8-12,15H,3-7H2,(H,24,26,27) |
| InChIKey | KKNBBIUSHUVKCU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|