About (5-cyano-3-pyridinyl) thiohypochlorite;ethane
(5-cyano-3-pyridinyl) thiohypochlorite;ethane (PubChem CID 177189379) has the molecular formula C8H9ClN2S
and a molecular weight of 200.69 g/mol. Its IUPAC name is (5-cyano-3-pyridinyl) thiohypochlorite;ethane.
Molecular Properties
| Compound Name | (5-cyano-3-pyridinyl) thiohypochlorite;ethane |
| PubChem CID | 177189379 |
| Molecular Formula | C8H9ClN2S |
| Molecular Weight | 200.69 g/mol |
| Exact Mass | 200.02 |
| IUPAC Name | (5-cyano-3-pyridinyl) thiohypochlorite;ethane |
| SMILES | CC.N#Cc1cncc(SCl)c1 |
| InChI | InChI=1S/C6H3ClN2S.C2H6/c7-10-6-1-5(2-8)3-9-4-6;1-2/h1,3-4H;1-2H3 |
| InChIKey | QEEFHAXATFFDBD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.69 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-cyano-3-pyridinyl) thiohypochlorite;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-cyano-3-pyridinyl) thiohypochlorite;ethane?
The IUPAC name of (5-cyano-3-pyridinyl) thiohypochlorite;ethane (CID 177189379) is (5-cyano-3-pyridinyl) thiohypochlorite;ethane.
What is the SMILES notation for (5-cyano-3-pyridinyl) thiohypochlorite;ethane?
The canonical SMILES for (5-cyano-3-pyridinyl) thiohypochlorite;ethane is CC.N#Cc1cncc(SCl)c1.
What is the InChIKey of (5-cyano-3-pyridinyl) thiohypochlorite;ethane?
The InChIKey is QEEFHAXATFFDBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3ClN2S.C2H6/c7-10-6-1-5(2-8)3-9-4-6;1-2/h1,3-4H;1-2H3.
What are the key properties of (5-cyano-3-pyridinyl) thiohypochlorite;ethane?
(5-cyano-3-pyridinyl) thiohypochlorite;ethane has a molecular weight of 200.69 g/mol, XLogP of 3.23, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-cyano-3-pyridinyl) thiohypochlorite;ethane is sourced from PubChem (CID 177189379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).