C15H11F4N3S — CID 168899060
5-[methyl-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]sulfanylpyridine-3-carbonitrile (PubChem CID 168899060) has the molecular formula C15H11F4N3S and a molecular weight of 341.33 g/mol. Its IUPAC name is 5-[methyl-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]sulfanylpyridine-3-carbonitrile.
| Compound Name | 5-[methyl-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]sulfanylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 168899060 |
| Molecular Formula | C15H11F4N3S |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 5-[methyl-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]sulfanylpyridine-3-carbonitrile |
| SMILES | CN(Sc1cncc(C#N)c1)C(c1ccc(F)cc1)C(F)(F)F |
| InChI | InChI=1S/C15H11F4N3S/c1-22(23-13-6-10(7-20)8-21-9-13)14(15(17,18)19)11-2-4-12(16)5-3-11/h2-6,8-9,14H,1H3 |
| InChIKey | FAXIEWRNXYCLKQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|