C15H13F4NO2S — CID 168898554
4-[methyl-[(1R)-2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]sulfanylbenzene-1,2-diol (PubChem CID 168898554) has the molecular formula C15H13F4NO2S and a molecular weight of 347.33 g/mol. Its IUPAC name is 4-[methyl-[(1R)-2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]sulfanylbenzene-1,2-diol.
| Compound Name | 4-[methyl-[(1R)-2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]sulfanylbenzene-1,2-diol |
|---|---|
| PubChem CID | 168898554 |
| Molecular Formula | C15H13F4NO2S |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 4-[methyl-[(1R)-2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]sulfanylbenzene-1,2-diol |
| SMILES | CN(Sc1ccc(O)c(O)c1)[C@H](c1ccc(F)cc1)C(F)(F)F |
| InChI | InChI=1S/C15H13F4NO2S/c1-20(23-11-6-7-12(21)13(22)8-11)14(15(17,18)19)9-2-4-10(16)5-3-9/h2-8,14,21-22H,1H3/t14-/m1/s1 |
| InChIKey | JTQJYZVEEDNGTL-CQSZACIVSA-N |
| XLogP | 4.48 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|