C17H13F6N3S — CID 177189572
5-[ethyl-[(1R)-2,2,2-trifluoro-1-[4-(trifluoromethyl)phenyl]ethyl]amino]sulfanylpyridine-3-carbonitrile (PubChem CID 177189572) has the molecular formula C17H13F6N3S and a molecular weight of 405.37 g/mol. Its IUPAC name is 5-[ethyl-[(1R)-2,2,2-trifluoro-1-[4-(trifluoromethyl)phenyl]ethyl]amino]sulfanylpyridine-3-carbonitrile.
| Compound Name | 5-[ethyl-[(1R)-2,2,2-trifluoro-1-[4-(trifluoromethyl)phenyl]ethyl]amino]sulfanylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 177189572 |
| Molecular Formula | C17H13F6N3S |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | 5-[ethyl-[(1R)-2,2,2-trifluoro-1-[4-(trifluoromethyl)phenyl]ethyl]amino]sulfanylpyridine-3-carbonitrile |
| SMILES | CCN(Sc1cncc(C#N)c1)[C@H](c1ccc(C(F)(F)F)cc1)C(F)(F)F |
| InChI | InChI=1S/C17H13F6N3S/c1-2-26(27-14-7-11(8-24)9-25-10-14)15(17(21,22)23)12-3-5-13(6-4-12)16(18,19)20/h3-7,9-10,15H,2H2,1H3/t15-/m1/s1 |
| InChIKey | JVPPNFVMBJIRDR-OAHLLOKOSA-N |
| XLogP | 5.60 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|