C15H9F6N3S — CID 168899110
5-[[2,2,2-trifluoro-1-[2-(trifluoromethyl)phenyl]ethyl]amino]sulfanylpyridine-3-carbonitrile (PubChem CID 168899110) has the molecular formula C15H9F6N3S and a molecular weight of 377.31 g/mol. Its IUPAC name is 5-[[2,2,2-trifluoro-1-[2-(trifluoromethyl)phenyl]ethyl]amino]sulfanylpyridine-3-carbonitrile.
| Compound Name | 5-[[2,2,2-trifluoro-1-[2-(trifluoromethyl)phenyl]ethyl]amino]sulfanylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 168899110 |
| Molecular Formula | C15H9F6N3S |
| Molecular Weight | 377.31 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | 5-[[2,2,2-trifluoro-1-[2-(trifluoromethyl)phenyl]ethyl]amino]sulfanylpyridine-3-carbonitrile |
| SMILES | N#Cc1cncc(SNC(c2ccccc2C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C15H9F6N3S/c16-14(17,18)12-4-2-1-3-11(12)13(15(19,20)21)24-25-10-5-9(6-22)7-23-8-10/h1-5,7-8,13,24H |
| InChIKey | WLEWQPUDTQIIQI-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.31 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|