C12H9F4N3S — CID 168898703
(1R)-2,2,2-trifluoro-1-(4-fluorophenyl)-N-pyrimidin-5-ylsulfanylethanamine (PubChem CID 168898703) has the molecular formula C12H9F4N3S and a molecular weight of 303.28 g/mol. Its IUPAC name is (1R)-2,2,2-trifluoro-1-(4-fluorophenyl)-N-pyrimidin-5-ylsulfanylethanamine.
| Compound Name | (1R)-2,2,2-trifluoro-1-(4-fluorophenyl)-N-pyrimidin-5-ylsulfanylethanamine |
|---|---|
| PubChem CID | 168898703 |
| Molecular Formula | C12H9F4N3S |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | (1R)-2,2,2-trifluoro-1-(4-fluorophenyl)-N-pyrimidin-5-ylsulfanylethanamine |
| SMILES | Fc1ccc([C@@H](NSc2cncnc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H9F4N3S/c13-9-3-1-8(2-4-9)11(12(14,15)16)19-20-10-5-17-7-18-6-10/h1-7,11,19H/t11-/m1/s1 |
| InChIKey | SKRRLYIADFZPPS-LLVKDONJSA-N |
| XLogP | 3.52 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|