C15H14F4N2OS — CID 172614396
5-fluoro-1-methyl-4-[[2,2,2-trifluoro-1-(4-methylphenyl)ethyl]amino]sulfanylpyridin-2-one (PubChem CID 172614396) has the molecular formula C15H14F4N2OS and a molecular weight of 346.35 g/mol. Its IUPAC name is 5-fluoro-1-methyl-4-[[2,2,2-trifluoro-1-(4-methylphenyl)ethyl]amino]sulfanylpyridin-2-one.
| Compound Name | 5-fluoro-1-methyl-4-[[2,2,2-trifluoro-1-(4-methylphenyl)ethyl]amino]sulfanylpyridin-2-one |
|---|---|
| PubChem CID | 172614396 |
| Molecular Formula | C15H14F4N2OS |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 5-fluoro-1-methyl-4-[[2,2,2-trifluoro-1-(4-methylphenyl)ethyl]amino]sulfanylpyridin-2-one |
| SMILES | Cc1ccc(C(NSc2cc(=O)n(C)cc2F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H14F4N2OS/c1-9-3-5-10(6-4-9)14(15(17,18)19)20-23-12-7-13(22)21(2)8-11(12)16/h3-8,14,20H,1-2H3 |
| InChIKey | ZHPTZZSMOHSVDS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|