C14H11F6N3OS — CID 172614506
2-methyl-5-[[2,2,2-trifluoro-1-[4-(trifluoromethyl)phenyl]ethyl]amino]sulfanylpyridazin-3-one (PubChem CID 172614506) has the molecular formula C14H11F6N3OS and a molecular weight of 383.32 g/mol. Its IUPAC name is 2-methyl-5-[[2,2,2-trifluoro-1-[4-(trifluoromethyl)phenyl]ethyl]amino]sulfanylpyridazin-3-one.
| Compound Name | 2-methyl-5-[[2,2,2-trifluoro-1-[4-(trifluoromethyl)phenyl]ethyl]amino]sulfanylpyridazin-3-one |
|---|---|
| PubChem CID | 172614506 |
| Molecular Formula | C14H11F6N3OS |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | 2-methyl-5-[[2,2,2-trifluoro-1-[4-(trifluoromethyl)phenyl]ethyl]amino]sulfanylpyridazin-3-one |
| SMILES | Cn1ncc(SNC(c2ccc(C(F)(F)F)cc2)C(F)(F)F)cc1=O |
| InChI | InChI=1S/C14H11F6N3OS/c1-23-11(24)6-10(7-21-23)25-22-12(14(18,19)20)8-2-4-9(5-3-8)13(15,16)17/h2-7,12,22H,1H3 |
| InChIKey | XIADINYCHPWYBW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|