About 1,6-dimethyl-N-[(1R)-1-[4-(trifluoromethyl)phenyl]ethyl]pyrazolo[3,4-d]pyrimidin-4-amine
1,6-dimethyl-N-[(1R)-1-[4-(trifluoromethyl)phenyl]ethyl]pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 134587658) has the molecular formula C16H16F3N5
and a molecular weight of 335.33 g/mol. Its IUPAC name is 1,6-dimethyl-N-[(1R)-1-[4-(trifluoromethyl)phenyl]ethyl]pyrazolo[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 1,6-dimethyl-N-[(1R)-1-[4-(trifluoromethyl)phenyl]ethyl]pyrazolo[3,4-d]pyrimidin-4-amine |
| PubChem CID | 134587658 |
| Molecular Formula | C16H16F3N5 |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 1,6-dimethyl-N-[(1R)-1-[4-(trifluoromethyl)phenyl]ethyl]pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Cc1nc(N[C@H](C)c2ccc(C(F)(F)F)cc2)c2cnn(C)c2n1 |
| InChI | InChI=1S/C16H16F3N5/c1-9(11-4-6-12(7-5-11)16(17,18)19)21-14-13-8-20-24(3)15(13)23-10(2)22-14/h4-9H,1-3H3,(H,21,22,23)/t9-/m1/s1 |
| InChIKey | XNZPHWRUVQOXID-SECBINFHSA-N |
| XLogP | 3.86 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,6-dimethyl-N-[(1R)-1-[4-(trifluoromethyl)phenyl]ethyl]pyrazolo[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dimethyl-N-[(1R)-1-[4-(trifluoromethyl)phenyl]ethyl]pyrazolo[3,4-d]pyrimidin-4-amine?
The IUPAC name of 1,6-dimethyl-N-[(1R)-1-[4-(trifluoromethyl)phenyl]ethyl]pyrazolo[3,4-d]pyrimidin-4-amine (CID 134587658) is 1,6-dimethyl-N-[(1R)-1-[4-(trifluoromethyl)phenyl]ethyl]pyrazolo[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for 1,6-dimethyl-N-[(1R)-1-[4-(trifluoromethyl)phenyl]ethyl]pyrazolo[3,4-d]pyrimidin-4-amine?
The canonical SMILES for 1,6-dimethyl-N-[(1R)-1-[4-(trifluoromethyl)phenyl]ethyl]pyrazolo[3,4-d]pyrimidin-4-amine is Cc1nc(N[C@H](C)c2ccc(C(F)(F)F)cc2)c2cnn(C)c2n1.
What is the InChIKey of 1,6-dimethyl-N-[(1R)-1-[4-(trifluoromethyl)phenyl]ethyl]pyrazolo[3,4-d]pyrimidin-4-amine?
The InChIKey is XNZPHWRUVQOXID-SECBINFHSA-N. The full InChI is InChI=1S/C16H16F3N5/c1-9(11-4-6-12(7-5-11)16(17,18)19)21-14-13-8-20-24(3)15(13)23-10(2)22-14/h4-9H,1-3H3,(H,21,22,23)/t9-/m1/s1.
What are the key properties of 1,6-dimethyl-N-[(1R)-1-[4-(trifluoromethyl)phenyl]ethyl]pyrazolo[3,4-d]pyrimidin-4-amine?
1,6-dimethyl-N-[(1R)-1-[4-(trifluoromethyl)phenyl]ethyl]pyrazolo[3,4-d]pyrimidin-4-amine has a molecular weight of 335.33 g/mol, XLogP of 3.86, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dimethyl-N-[(1R)-1-[4-(trifluoromethyl)phenyl]ethyl]pyrazolo[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 134587658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).