C26H24F3N7O — CID 164544935
5-[10-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-4,12-dimethyl-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-7-yl]-1-methylpyridin-2-one (PubChem CID 164544935) has the molecular formula C26H24F3N7O and a molecular weight of 507.52 g/mol. Its IUPAC name is 5-[10-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-4,12-dimethyl-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-7-yl]-1-methylpyridin-2-one.
| Compound Name | 5-[10-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-4,12-dimethyl-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-7-yl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 164544935 |
| Molecular Formula | C26H24F3N7O |
| Molecular Weight | 507.52 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | 5-[10-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-4,12-dimethyl-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-7-yl]-1-methylpyridin-2-one |
| SMILES | Cc1cn2c(n1)c(-c1ccc(=O)n(C)c1)cc1c(N[C@H](C)c3cc(N)cc(C(F)(F)F)c3)nc(C)nc12 |
| InChI | InChI=1S/C26H24F3N7O/c1-13-11-36-24(31-13)20(16-5-6-22(37)35(4)12-16)10-21-23(33-15(3)34-25(21)36)32-14(2)17-7-18(26(27,28)29)9-19(30)8-17/h5-12,14H,30H2,1-4H3,(H,32,33,34)/t14-/m1/s1 |
| InChIKey | UIJIGOPRJYMNGN-CQSZACIVSA-N |
| XLogP | 5.03 |
| TPSA | 103.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.52 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|