C19H21F3N5OP — CID 164897555
N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-6-dimethylphosphoryl-2-methylpyrido[2,3-d]pyrimidin-4-amine (PubChem CID 164897555) has the molecular formula C19H21F3N5OP and a molecular weight of 423.38 g/mol. Its IUPAC name is N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-6-dimethylphosphoryl-2-methylpyrido[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-6-dimethylphosphoryl-2-methylpyrido[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 164897555 |
| Molecular Formula | C19H21F3N5OP |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-6-dimethylphosphoryl-2-methylpyrido[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1nc(N[C@H](C)c2cc(N)cc(C(F)(F)F)c2)c2cc(P(C)(C)=O)cnc2n1 |
| InChI | InChI=1S/C19H21F3N5OP/c1-10(12-5-13(19(20,21)22)7-14(23)6-12)25-18-16-8-15(29(3,4)28)9-24-17(16)26-11(2)27-18/h5-10H,23H2,1-4H3,(H,24,25,26,27)/t10-/m1/s1 |
| InChIKey | JEVMICNLVFYQPE-SNVBAGLBSA-N |
| XLogP | 4.36 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|