C23H22F3N5O — CID 163365574
N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-6-(2-cyclopropylethynyl)-7-methoxy-2-methylpyrido[2,3-d]pyrimidin-4-amine (PubChem CID 163365574) has the molecular formula C23H22F3N5O and a molecular weight of 441.46 g/mol. Its IUPAC name is N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-6-(2-cyclopropylethynyl)-7-methoxy-2-methylpyrido[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-6-(2-cyclopropylethynyl)-7-methoxy-2-methylpyrido[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 163365574 |
| Molecular Formula | C23H22F3N5O |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-6-(2-cyclopropylethynyl)-7-methoxy-2-methylpyrido[2,3-d]pyrimidin-4-amine |
| SMILES | COc1nc2nc(C)nc(N[C@H](C)c3cc(N)cc(C(F)(F)F)c3)c2cc1C#CC1CC1 |
| InChI | InChI=1S/C23H22F3N5O/c1-12(16-8-17(23(24,25)26)11-18(27)9-16)28-20-19-10-15(7-6-14-4-5-14)22(32-3)31-21(19)30-13(2)29-20/h8-12,14H,4-5,27H2,1-3H3,(H,28,29,30,31)/t12-/m1/s1 |
| InChIKey | SKVUBSJAKNUYBT-GFCCVEGCSA-N |
| XLogP | 4.88 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|