C24H26F3N5O2 — CID 165178668
N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-8-methyl-4-piperidin-4-yl-[1,3]dioxolo[4,5-h]quinazolin-6-amine (PubChem CID 165178668) has the molecular formula C24H26F3N5O2 and a molecular weight of 473.50 g/mol. Its IUPAC name is N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-8-methyl-4-piperidin-4-yl-[1,3]dioxolo[4,5-h]quinazolin-6-amine.
| Compound Name | N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-8-methyl-4-piperidin-4-yl-[1,3]dioxolo[4,5-h]quinazolin-6-amine |
|---|---|
| PubChem CID | 165178668 |
| Molecular Formula | C24H26F3N5O2 |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-8-methyl-4-piperidin-4-yl-[1,3]dioxolo[4,5-h]quinazolin-6-amine |
| SMILES | Cc1nc(N[C@H](C)c2cc(N)cc(C(F)(F)F)c2)c2cc(C3CCNCC3)c3c(c2n1)OCO3 |
| InChI | InChI=1S/C24H26F3N5O2/c1-12(15-7-16(24(25,26)27)9-17(28)8-15)30-23-19-10-18(14-3-5-29-6-4-14)21-22(34-11-33-21)20(19)31-13(2)32-23/h7-10,12,14,29H,3-6,11,28H2,1-2H3,(H,30,31,32)/t12-/m1/s1 |
| InChIKey | WTCKZPQHHASGJL-GFCCVEGCSA-N |
| XLogP | 4.91 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|