C20H19F3N4 — CID 175836509
N-[1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-2-cyclopropyl-6-deuterioquinazolin-4-amine (PubChem CID 175836509) has the molecular formula C20H19F3N4 and a molecular weight of 373.40 g/mol. Its IUPAC name is N-[1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-2-cyclopropyl-6-deuterioquinazolin-4-amine.
| Compound Name | N-[1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-2-cyclopropyl-6-deuterioquinazolin-4-amine |
|---|---|
| PubChem CID | 175836509 |
| Molecular Formula | C20H19F3N4 |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N-[1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-2-cyclopropyl-6-deuterioquinazolin-4-amine |
| SMILES | [2H]c1ccc2nc(C3CC3)nc(NC(C)c3cc(N)cc(C(F)(F)F)c3)c2c1 |
| InChI | InChI=1S/C20H19F3N4/c1-11(13-8-14(20(21,22)23)10-15(24)9-13)25-19-16-4-2-3-5-17(16)26-18(27-19)12-6-7-12/h2-5,8-12H,6-7,24H2,1H3,(H,25,26,27)/i2D |
| InChIKey | JJUIFAJEQUFQNL-VMNATFBRSA-N |
| XLogP | 5.28 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|