C22H23F3N3OP — CID 175277340
2-cyclopropyl-6-dimethylphosphoryl-N-[1-[3-(trifluoromethyl)phenyl]ethyl]quinazolin-4-amine (PubChem CID 175277340) has the molecular formula C22H23F3N3OP and a molecular weight of 433.41 g/mol. Its IUPAC name is 2-cyclopropyl-6-dimethylphosphoryl-N-[1-[3-(trifluoromethyl)phenyl]ethyl]quinazolin-4-amine.
| Compound Name | 2-cyclopropyl-6-dimethylphosphoryl-N-[1-[3-(trifluoromethyl)phenyl]ethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 175277340 |
| Molecular Formula | C22H23F3N3OP |
| Molecular Weight | 433.41 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 2-cyclopropyl-6-dimethylphosphoryl-N-[1-[3-(trifluoromethyl)phenyl]ethyl]quinazolin-4-amine |
| SMILES | CC(Nc1nc(C2CC2)nc2ccc(P(C)(C)=O)cc12)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H23F3N3OP/c1-13(15-5-4-6-16(11-15)22(23,24)25)26-21-18-12-17(30(2,3)29)9-10-19(18)27-20(28-21)14-7-8-14/h4-6,9-14H,7-8H2,1-3H3,(H,26,27,28) |
| InChIKey | DIQQVBFGUHJGFL-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.41 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|