C25H27F3N4O3 — CID 175324522
N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-2-cyclopropyl-7-methoxy-6-(oxolan-3-yloxy)quinazolin-4-amine (PubChem CID 175324522) has the molecular formula C25H27F3N4O3 and a molecular weight of 488.51 g/mol. Its IUPAC name is N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-2-cyclopropyl-7-methoxy-6-(oxolan-3-yloxy)quinazolin-4-amine.
| Compound Name | N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-2-cyclopropyl-7-methoxy-6-(oxolan-3-yloxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 175324522 |
| Molecular Formula | C25H27F3N4O3 |
| Molecular Weight | 488.51 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-2-cyclopropyl-7-methoxy-6-(oxolan-3-yloxy)quinazolin-4-amine |
| SMILES | COc1cc2nc(C3CC3)nc(N[C@H](C)c3cc(N)cc(C(F)(F)F)c3)c2cc1OC1CCOC1 |
| InChI | InChI=1S/C25H27F3N4O3/c1-13(15-7-16(25(26,27)28)9-17(29)8-15)30-24-19-10-22(35-18-5-6-34-12-18)21(33-2)11-20(19)31-23(32-24)14-3-4-14/h7-11,13-14,18H,3-6,12,29H2,1-2H3,(H,30,31,32)/t13-,18?/m1/s1 |
| InChIKey | CMODVVXXGXSZOX-YJJYDOSJSA-N |
| XLogP | 5.46 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.51 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|