C25H25F3N4O5 — CID 166065008
2-cyclopropyl-7-methoxy-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-6-[(3S)-oxolan-3-yl]oxyquinazolin-4-amine (PubChem CID 166065008) has the molecular formula C25H25F3N4O5 and a molecular weight of 518.49 g/mol. Its IUPAC name is 2-cyclopropyl-7-methoxy-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-6-[(3S)-oxolan-3-yl]oxyquinazolin-4-amine.
| Compound Name | 2-cyclopropyl-7-methoxy-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-6-[(3S)-oxolan-3-yl]oxyquinazolin-4-amine |
|---|---|
| PubChem CID | 166065008 |
| Molecular Formula | C25H25F3N4O5 |
| Molecular Weight | 518.49 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | 2-cyclopropyl-7-methoxy-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-6-[(3S)-oxolan-3-yl]oxyquinazolin-4-amine |
| SMILES | COc1cc2nc(C3CC3)nc(N[C@H](C)c3cc([N+](=O)[O-])cc(C(F)(F)F)c3)c2cc1O[C@H]1CCOC1 |
| InChI | InChI=1S/C25H25F3N4O5/c1-13(15-7-16(25(26,27)28)9-17(8-15)32(33)34)29-24-19-10-22(37-18-5-6-36-12-18)21(35-2)11-20(19)30-23(31-24)14-3-4-14/h7-11,13-14,18H,3-6,12H2,1-2H3,(H,29,30,31)/t13-,18+/m1/s1 |
| InChIKey | SBIOMNDPQKWIGD-ACJLOTCBSA-N |
| XLogP | 5.78 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.49 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|