C24H22F3N5O5 — CID 175986014
2-methoxy-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-7-[(3S)-oxolan-3-yl]oxypyrazolo[1,5-a]quinazolin-5-amine (PubChem CID 175986014) has the molecular formula C24H22F3N5O5 and a molecular weight of 517.46 g/mol. Its IUPAC name is 2-methoxy-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-7-[(3S)-oxolan-3-yl]oxypyrazolo[1,5-a]quinazolin-5-amine.
| Compound Name | 2-methoxy-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-7-[(3S)-oxolan-3-yl]oxypyrazolo[1,5-a]quinazolin-5-amine |
|---|---|
| PubChem CID | 175986014 |
| Molecular Formula | C24H22F3N5O5 |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | 2-methoxy-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-7-[(3S)-oxolan-3-yl]oxypyrazolo[1,5-a]quinazolin-5-amine |
| SMILES | COc1cc2nc(N[C@H](C)c3cc([N+](=O)[O-])cc(C(F)(F)F)c3)c3cc(O[C@H]4CCOC4)ccc3n2n1 |
| InChI | InChI=1S/C24H22F3N5O5/c1-13(14-7-15(24(25,26)27)9-16(8-14)32(33)34)28-23-19-10-17(37-18-5-6-36-12-18)3-4-20(19)31-21(29-23)11-22(30-31)35-2/h3-4,7-11,13,18H,5-6,12H2,1-2H3,(H,28,29)/t13-,18+/m1/s1 |
| InChIKey | VSDRTNAIPNDQHH-ACJLOTCBSA-N |
| XLogP | 5.16 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|