C21H19F3N4O4 — CID 176752256
4-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-7-[(3S)-oxolan-3-yl]oxyphthalazin-1-amine (PubChem CID 176752256) has the molecular formula C21H19F3N4O4 and a molecular weight of 448.40 g/mol. Its IUPAC name is 4-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-7-[(3S)-oxolan-3-yl]oxyphthalazin-1-amine.
| Compound Name | 4-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-7-[(3S)-oxolan-3-yl]oxyphthalazin-1-amine |
|---|---|
| PubChem CID | 176752256 |
| Molecular Formula | C21H19F3N4O4 |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 4-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-7-[(3S)-oxolan-3-yl]oxyphthalazin-1-amine |
| SMILES | C[C@H](c1cc([N+](=O)[O-])cc(C(F)(F)F)c1)c1nnc(N)c2cc(O[C@H]3CCOC3)ccc12 |
| InChI | InChI=1S/C21H19F3N4O4/c1-11(12-6-13(21(22,23)24)8-14(7-12)28(29)30)19-17-3-2-15(32-16-4-5-31-10-16)9-18(17)20(25)27-26-19/h2-3,6-9,11,16H,4-5,10H2,1H3,(H2,25,27)/t11-,16+/m1/s1 |
| InChIKey | SKCAQRGQIGCKOC-BZNIZROVSA-N |
| XLogP | 4.46 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|