C22H23F3N4O3 — CID 164522674
4-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-2-methyl-6-[(3S)-oxolan-3-yl]oxyphthalazin-1-one (PubChem CID 164522674) has the molecular formula C22H23F3N4O3 and a molecular weight of 448.45 g/mol. Its IUPAC name is 4-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-2-methyl-6-[(3S)-oxolan-3-yl]oxyphthalazin-1-one.
| Compound Name | 4-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-2-methyl-6-[(3S)-oxolan-3-yl]oxyphthalazin-1-one |
|---|---|
| PubChem CID | 164522674 |
| Molecular Formula | C22H23F3N4O3 |
| Molecular Weight | 448.45 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 4-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-2-methyl-6-[(3S)-oxolan-3-yl]oxyphthalazin-1-one |
| SMILES | C[C@@H](Nc1nn(C)c(=O)c2ccc(O[C@H]3CCOC3)cc12)c1cc(N)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H23F3N4O3/c1-12(13-7-14(22(23,24)25)9-15(26)8-13)27-20-19-10-16(32-17-5-6-31-11-17)3-4-18(19)21(30)29(2)28-20/h3-4,7-10,12,17H,5-6,11,26H2,1-2H3,(H,27,28)/t12-,17+/m1/s1 |
| InChIKey | QRKMGOVWQRKJIT-PXAZEXFGSA-N |
| XLogP | 3.88 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|