C22H22F3N3O3 — CID 162763389
N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-5-[(3S)-oxolan-3-yl]oxy-1H-indole-7-carboxamide (PubChem CID 162763389) has the molecular formula C22H22F3N3O3 and a molecular weight of 433.43 g/mol. Its IUPAC name is N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-5-[(3S)-oxolan-3-yl]oxy-1H-indole-7-carboxamide.
| Compound Name | N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-5-[(3S)-oxolan-3-yl]oxy-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 162763389 |
| Molecular Formula | C22H22F3N3O3 |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-5-[(3S)-oxolan-3-yl]oxy-1H-indole-7-carboxamide |
| SMILES | C[C@@H](NC(=O)c1cc(O[C@H]2CCOC2)cc2cc[nH]c12)c1cc(N)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H22F3N3O3/c1-12(14-6-15(22(23,24)25)9-16(26)7-14)28-21(29)19-10-18(31-17-3-5-30-11-17)8-13-2-4-27-20(13)19/h2,4,6-10,12,17,27H,3,5,11,26H2,1H3,(H,28,29)/t12-,17+/m1/s1 |
| InChIKey | GWDOLJQWSVSQKO-PXAZEXFGSA-N |
| XLogP | 4.43 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|