C24H26F3N5O3 — CID 175266213
6-(1-acetylpyrrolidin-3-yl)oxy-4-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-2-methylphthalazin-1-one (PubChem CID 175266213) has the molecular formula C24H26F3N5O3 and a molecular weight of 489.50 g/mol. Its IUPAC name is 6-(1-acetylpyrrolidin-3-yl)oxy-4-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-2-methylphthalazin-1-one.
| Compound Name | 6-(1-acetylpyrrolidin-3-yl)oxy-4-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-2-methylphthalazin-1-one |
|---|---|
| PubChem CID | 175266213 |
| Molecular Formula | C24H26F3N5O3 |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | 6-(1-acetylpyrrolidin-3-yl)oxy-4-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-2-methylphthalazin-1-one |
| SMILES | CC(=O)N1CCC(Oc2ccc3c(=O)n(C)nc(N[C@H](C)c4cc(N)cc(C(F)(F)F)c4)c3c2)C1 |
| InChI | InChI=1S/C24H26F3N5O3/c1-13(15-8-16(24(25,26)27)10-17(28)9-15)29-22-21-11-18(4-5-20(21)23(34)31(3)30-22)35-19-6-7-32(12-19)14(2)33/h4-5,8-11,13,19H,6-7,12,28H2,1-3H3,(H,29,30)/t13-,19?/m1/s1 |
| InChIKey | GTOQCEZULLJZKM-BSOCMFCZSA-N |
| XLogP | 3.71 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|