C21H22F3N5O2 — CID 172782325
4-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-6-morpholin-4-yl-2H-phthalazin-1-one (PubChem CID 172782325) has the molecular formula C21H22F3N5O2 and a molecular weight of 433.43 g/mol. Its IUPAC name is 4-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-6-morpholin-4-yl-2H-phthalazin-1-one.
| Compound Name | 4-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-6-morpholin-4-yl-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 172782325 |
| Molecular Formula | C21H22F3N5O2 |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 4-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-6-morpholin-4-yl-2H-phthalazin-1-one |
| SMILES | C[C@@H](Nc1n[nH]c(=O)c2ccc(N3CCOCC3)cc12)c1cc(N)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H22F3N5O2/c1-12(13-8-14(21(22,23)24)10-15(25)9-13)26-19-18-11-16(29-4-6-31-7-5-29)2-3-17(18)20(30)28-27-19/h2-3,8-12H,4-7,25H2,1H3,(H,26,27)(H,28,30)/t12-/m1/s1 |
| InChIKey | OKRFLAHVUDCNPN-GFCCVEGCSA-N |
| XLogP | 3.53 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|