C23H27F3N6 — CID 176726167
N-[1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-3-(4-ethylpiperazin-1-yl)-1,7-naphthyridin-5-amine (PubChem CID 176726167) has the molecular formula C23H27F3N6 and a molecular weight of 444.51 g/mol. Its IUPAC name is N-[1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-3-(4-ethylpiperazin-1-yl)-1,7-naphthyridin-5-amine.
| Compound Name | N-[1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-3-(4-ethylpiperazin-1-yl)-1,7-naphthyridin-5-amine |
|---|---|
| PubChem CID | 176726167 |
| Molecular Formula | C23H27F3N6 |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | N-[1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-3-(4-ethylpiperazin-1-yl)-1,7-naphthyridin-5-amine |
| SMILES | CCN1CCN(c2cnc3cncc(NC(C)c4cc(N)cc(C(F)(F)F)c4)c3c2)CC1 |
| InChI | InChI=1S/C23H27F3N6/c1-3-31-4-6-32(7-5-31)19-11-20-21(29-12-19)13-28-14-22(20)30-15(2)16-8-17(23(24,25)26)10-18(27)9-16/h8-15,30H,3-7,27H2,1-2H3 |
| InChIKey | JKIVBTZENLOVOQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|