C21H21ClF3N5O — CID 176726194
N-[1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-2-chloro-6-morpholin-4-yl-1,8-naphthyridin-4-amine (PubChem CID 176726194) has the molecular formula C21H21ClF3N5O and a molecular weight of 451.88 g/mol. Its IUPAC name is N-[1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-2-chloro-6-morpholin-4-yl-1,8-naphthyridin-4-amine.
| Compound Name | N-[1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-2-chloro-6-morpholin-4-yl-1,8-naphthyridin-4-amine |
|---|---|
| PubChem CID | 176726194 |
| Molecular Formula | C21H21ClF3N5O |
| Molecular Weight | 451.88 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | N-[1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-2-chloro-6-morpholin-4-yl-1,8-naphthyridin-4-amine |
| SMILES | CC(Nc1cc(Cl)nc2ncc(N3CCOCC3)cc12)c1cc(N)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H21ClF3N5O/c1-12(13-6-14(21(23,24)25)8-15(26)7-13)28-18-10-19(22)29-20-17(18)9-16(11-27-20)30-2-4-31-5-3-30/h6-12H,2-5,26H2,1H3,(H,27,28,29) |
| InChIKey | OJLXAXXNGJNLHL-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.88 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|