C21H23F3N6O — CID 176710261
N-[1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-4-methyl-7-morpholin-4-ylpyrido[3,4-d]pyridazin-1-amine (PubChem CID 176710261) has the molecular formula C21H23F3N6O and a molecular weight of 432.45 g/mol. Its IUPAC name is N-[1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-4-methyl-7-morpholin-4-ylpyrido[3,4-d]pyridazin-1-amine.
| Compound Name | N-[1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-4-methyl-7-morpholin-4-ylpyrido[3,4-d]pyridazin-1-amine |
|---|---|
| PubChem CID | 176710261 |
| Molecular Formula | C21H23F3N6O |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | N-[1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-4-methyl-7-morpholin-4-ylpyrido[3,4-d]pyridazin-1-amine |
| SMILES | Cc1nnc(NC(C)c2cc(N)cc(C(F)(F)F)c2)c2cc(N3CCOCC3)ncc12 |
| InChI | InChI=1S/C21H23F3N6O/c1-12(14-7-15(21(22,23)24)9-16(25)8-14)27-20-17-10-19(30-3-5-31-6-4-30)26-11-18(17)13(2)28-29-20/h7-12H,3-6,25H2,1-2H3,(H,27,29) |
| InChIKey | OJSIUVKRCZORAQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|