C26H27BF3N5O5 — CID 174222641
8-methoxy-N-[1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]quinazolin-5-amine (PubChem CID 174222641) has the molecular formula C26H27BF3N5O5 and a molecular weight of 557.34 g/mol. Its IUPAC name is 8-methoxy-N-[1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]quinazolin-5-amine.
| Compound Name | 8-methoxy-N-[1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]quinazolin-5-amine |
|---|---|
| PubChem CID | 174222641 |
| Molecular Formula | C26H27BF3N5O5 |
| Molecular Weight | 557.34 g/mol |
| Exact Mass | 557.21 |
| IUPAC Name | 8-methoxy-N-[1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]quinazolin-5-amine |
| SMILES | COc1cc2c(cc1B1OC(C)(C)C(C)(C)O1)c(NC(C)c1cc([N+](=O)[O-])cc(C(F)(F)F)c1)nc1ccnn12 |
| InChI | InChI=1S/C26H27BF3N5O5/c1-14(15-9-16(26(28,29)30)11-17(10-15)35(36)37)32-23-18-12-19(27-39-24(2,3)25(4,5)40-27)21(38-6)13-20(18)34-22(33-23)7-8-31-34/h7-14H,1-6H3,(H,32,33) |
| InChIKey | ZOYDNUJQQOYZCP-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.34 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|