C23H25F3N5O4P — CID 163795756
7-methoxy-2-methyl-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-6-(4-oxo-1,4λ5-azaphosphinan-4-yl)quinazolin-4-amine (PubChem CID 163795756) has the molecular formula C23H25F3N5O4P and a molecular weight of 523.45 g/mol. Its IUPAC name is 7-methoxy-2-methyl-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-6-(4-oxo-1,4λ5-azaphosphinan-4-yl)quinazolin-4-amine.
| Compound Name | 7-methoxy-2-methyl-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-6-(4-oxo-1,4λ5-azaphosphinan-4-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 163795756 |
| Molecular Formula | C23H25F3N5O4P |
| Molecular Weight | 523.45 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | 7-methoxy-2-methyl-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-6-(4-oxo-1,4λ5-azaphosphinan-4-yl)quinazolin-4-amine |
| SMILES | COc1cc2nc(C)nc(N[C@H](C)c3cc([N+](=O)[O-])cc(C(F)(F)F)c3)c2cc1P1(=O)CCNCC1 |
| InChI | InChI=1S/C23H25F3N5O4P/c1-13(15-8-16(23(24,25)26)10-17(9-15)31(32)33)28-22-18-11-21(36(34)6-4-27-5-7-36)20(35-3)12-19(18)29-14(2)30-22/h8-13,27H,4-7H2,1-3H3,(H,28,29,30)/t13-/m1/s1 |
| InChIKey | NAPRZVOTLIOUKQ-CYBMUJFWSA-N |
| XLogP | 4.64 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|