C24H23F3N8O2 — CID 172858439
2-methyl-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-6-(1H-pyrazol-4-yl)-7-pyrrolidin-1-ylpyrido[2,3-d]pyrimidin-4-amine (PubChem CID 172858439) has the molecular formula C24H23F3N8O2 and a molecular weight of 512.50 g/mol. Its IUPAC name is 2-methyl-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-6-(1H-pyrazol-4-yl)-7-pyrrolidin-1-ylpyrido[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-methyl-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-6-(1H-pyrazol-4-yl)-7-pyrrolidin-1-ylpyrido[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 172858439 |
| Molecular Formula | C24H23F3N8O2 |
| Molecular Weight | 512.50 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | 2-methyl-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-6-(1H-pyrazol-4-yl)-7-pyrrolidin-1-ylpyrido[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1nc(N[C@H](C)c2cc([N+](=O)[O-])cc(C(F)(F)F)c2)c2cc(-c3cn[nH]c3)c(N3CCCC3)nc2n1 |
| InChI | InChI=1S/C24H23F3N8O2/c1-13(15-7-17(24(25,26)27)9-18(8-15)35(36)37)30-21-20-10-19(16-11-28-29-12-16)23(34-5-3-4-6-34)33-22(20)32-14(2)31-21/h7-13H,3-6H2,1-2H3,(H,28,29)(H,30,31,32,33)/t13-/m1/s1 |
| InChIKey | ZAJPVLDRAITROP-CYBMUJFWSA-N |
| XLogP | 5.42 |
| TPSA | 125.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.50 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|