C25H29F2N7O3 — CID 175758732
4-[[(1R)-1-[3-(1,1-difluoroethyl)-5-nitrophenyl]ethyl]amino]-N,N,2-trimethyl-7-pyrrolidin-1-ylpyrido[2,3-d]pyrimidine-6-carboxamide (PubChem CID 175758732) has the molecular formula C25H29F2N7O3 and a molecular weight of 513.55 g/mol. Its IUPAC name is 4-[[(1R)-1-[3-(1,1-difluoroethyl)-5-nitrophenyl]ethyl]amino]-N,N,2-trimethyl-7-pyrrolidin-1-ylpyrido[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 4-[[(1R)-1-[3-(1,1-difluoroethyl)-5-nitrophenyl]ethyl]amino]-N,N,2-trimethyl-7-pyrrolidin-1-ylpyrido[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 175758732 |
| Molecular Formula | C25H29F2N7O3 |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | 4-[[(1R)-1-[3-(1,1-difluoroethyl)-5-nitrophenyl]ethyl]amino]-N,N,2-trimethyl-7-pyrrolidin-1-ylpyrido[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1nc(N[C@H](C)c2cc([N+](=O)[O-])cc(C(C)(F)F)c2)c2cc(C(=O)N(C)C)c(N3CCCC3)nc2n1 |
| InChI | InChI=1S/C25H29F2N7O3/c1-14(16-10-17(25(3,26)27)12-18(11-16)34(36)37)28-21-19-13-20(24(35)32(4)5)23(33-8-6-7-9-33)31-22(19)30-15(2)29-21/h10-14H,6-9H2,1-5H3,(H,28,29,30,31)/t14-/m1/s1 |
| InChIKey | ZULMNMPLCBAUGQ-CQSZACIVSA-N |
| XLogP | 4.83 |
| TPSA | 117.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|