C27H26F3N7O2 — CID 172732253
2-methyl-6-(3-methyl-4-pyridinyl)-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-7-pyrrolidin-1-ylpyrido[2,3-d]pyrimidin-4-amine (PubChem CID 172732253) has the molecular formula C27H26F3N7O2 and a molecular weight of 537.55 g/mol. Its IUPAC name is 2-methyl-6-(3-methyl-4-pyridinyl)-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-7-pyrrolidin-1-ylpyrido[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-methyl-6-(3-methyl-4-pyridinyl)-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-7-pyrrolidin-1-ylpyrido[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 172732253 |
| Molecular Formula | C27H26F3N7O2 |
| Molecular Weight | 537.55 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | 2-methyl-6-(3-methyl-4-pyridinyl)-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-7-pyrrolidin-1-ylpyrido[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1nc(N[C@H](C)c2cc([N+](=O)[O-])cc(C(F)(F)F)c2)c2cc(-c3ccncc3C)c(N3CCCC3)nc2n1 |
| InChI | InChI=1S/C27H26F3N7O2/c1-15-14-31-7-6-21(15)22-13-23-24(33-17(3)34-25(23)35-26(22)36-8-4-5-9-36)32-16(2)18-10-19(27(28,29)30)12-20(11-18)37(38)39/h6-7,10-14,16H,4-5,8-9H2,1-3H3,(H,32,33,34,35)/t16-/m1/s1 |
| InChIKey | HYKPJTXKJFFIJW-MRXNPFEDSA-N |
| XLogP | 6.40 |
| TPSA | 109.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.55 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|