C22H22F3N5O4 — CID 172843455
6-(1-ethoxyethenyl)-7-methoxy-2-methyl-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]pyrido[2,3-d]pyrimidin-4-amine (PubChem CID 172843455) has the molecular formula C22H22F3N5O4 and a molecular weight of 477.44 g/mol. Its IUPAC name is 6-(1-ethoxyethenyl)-7-methoxy-2-methyl-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]pyrido[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-(1-ethoxyethenyl)-7-methoxy-2-methyl-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]pyrido[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 172843455 |
| Molecular Formula | C22H22F3N5O4 |
| Molecular Weight | 477.44 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 6-(1-ethoxyethenyl)-7-methoxy-2-methyl-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]pyrido[2,3-d]pyrimidin-4-amine |
| SMILES | C=C(OCC)c1cc2c(N[C@H](C)c3cc([N+](=O)[O-])cc(C(F)(F)F)c3)nc(C)nc2nc1OC |
| InChI | InChI=1S/C22H22F3N5O4/c1-6-34-12(3)17-10-18-19(27-13(4)28-20(18)29-21(17)33-5)26-11(2)14-7-15(22(23,24)25)9-16(8-14)30(31)32/h7-11H,3,6H2,1-2,4-5H3,(H,26,27,28,29)/t11-/m1/s1 |
| InChIKey | XCIYLUBDPCGXSP-LLVKDONJSA-N |
| XLogP | 5.45 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.44 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|