C22H23F3N4O8 — CID 175390914
dimethyl 2-[5-(1,3-dioxolan-2-yl)-2-methyl-6-[1-[3-nitro-5-(trifluoromethyl)phenyl]ethylamino]pyrimidin-4-yl]propanedioate (PubChem CID 175390914) has the molecular formula C22H23F3N4O8 and a molecular weight of 528.44 g/mol. Its IUPAC name is dimethyl 2-[5-(1,3-dioxolan-2-yl)-2-methyl-6-[1-[3-nitro-5-(trifluoromethyl)phenyl]ethylamino]pyrimidin-4-yl]propanedioate.
| Compound Name | dimethyl 2-[5-(1,3-dioxolan-2-yl)-2-methyl-6-[1-[3-nitro-5-(trifluoromethyl)phenyl]ethylamino]pyrimidin-4-yl]propanedioate |
|---|---|
| PubChem CID | 175390914 |
| Molecular Formula | C22H23F3N4O8 |
| Molecular Weight | 528.44 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | dimethyl 2-[5-(1,3-dioxolan-2-yl)-2-methyl-6-[1-[3-nitro-5-(trifluoromethyl)phenyl]ethylamino]pyrimidin-4-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)c1nc(C)nc(NC(C)c2cc([N+](=O)[O-])cc(C(F)(F)F)c2)c1C1OCCO1 |
| InChI | InChI=1S/C22H23F3N4O8/c1-10(12-7-13(22(23,24)25)9-14(8-12)29(32)33)26-18-15(21-36-5-6-37-21)17(27-11(2)28-18)16(19(30)34-3)20(31)35-4/h7-10,16,21H,5-6H2,1-4H3,(H,26,27,28) |
| InChIKey | RUXICXRMYSEREN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 152.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|