C30H31F3N6O4 — CID 166541310
2-[2-methoxy-3-[methyl-[2-methyl-4-[[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]amino]quinazolin-6-yl]amino]phenyl]-N,N-dimethylacetamide (PubChem CID 166541310) has the molecular formula C30H31F3N6O4 and a molecular weight of 596.61 g/mol. Its IUPAC name is 2-[2-methoxy-3-[methyl-[2-methyl-4-[[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]amino]quinazolin-6-yl]amino]phenyl]-N,N-dimethylacetamide.
| Compound Name | 2-[2-methoxy-3-[methyl-[2-methyl-4-[[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]amino]quinazolin-6-yl]amino]phenyl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 166541310 |
| Molecular Formula | C30H31F3N6O4 |
| Molecular Weight | 596.61 g/mol |
| Exact Mass | 596.24 |
| IUPAC Name | 2-[2-methoxy-3-[methyl-[2-methyl-4-[[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]amino]quinazolin-6-yl]amino]phenyl]-N,N-dimethylacetamide |
| SMILES | COc1c(CC(=O)N(C)C)cccc1N(C)c1ccc2nc(C)nc(N[C@H](C)c3cc([N+](=O)[O-])cc(C(F)(F)F)c3)c2c1 |
| InChI | InChI=1S/C30H31F3N6O4/c1-17(20-12-21(30(31,32)33)15-23(13-20)39(41)42)34-29-24-16-22(10-11-25(24)35-18(2)36-29)38(5)26-9-7-8-19(28(26)43-6)14-27(40)37(3)4/h7-13,15-17H,14H2,1-6H3,(H,34,35,36)/t17-/m1/s1 |
| InChIKey | LYTQUSUMFHCZLK-QGZVFWFLSA-N |
| XLogP | 6.45 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.61 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|